C22H11F5N2O4 — CID 2275912
N-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 2275912) has the molecular formula C22H11F5N2O4 and a molecular weight of 462.33 g/mol. Its IUPAC name is N-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 2275912 |
| Molecular Formula | C22H11F5N2O4 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3c(F)c(F)c(F)c(F)c3F)nc2c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H11F5N2O4/c23-16-15(17(24)19(26)20(27)18(16)25)22-29-11-8-10(2-4-12(11)33-22)28-21(30)9-1-3-13-14(7-9)32-6-5-31-13/h1-4,7-8H,5-6H2,(H,28,30) |
| InChIKey | ISMICMFJUPXHCR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|