About chromium(2+);bis(heptanoate)
chromium(2+);bis(heptanoate) (PubChem CID 22759575) has the molecular formula C14H26CrO4
and a molecular weight of 310.35 g/mol. Its IUPAC name is chromium(2+);bis(heptanoate).
Molecular Properties
| Compound Name | chromium(2+);bis(heptanoate) |
| PubChem CID | 22759575 |
| Molecular Formula | C14H26CrO4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | chromium(2+);bis(heptanoate) |
| SMILES | CCCCCCC(=O)[O-].CCCCCCC(=O)[O-].[Cr+2] |
| InChI | InChI=1S/2C7H14O2.Cr/c2*1-2-3-4-5-6-7(8)9;/h2*2-6H2,1H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | CZPDWLPNISOUFN-UHFFFAOYSA-L |
| XLogP | 1.41 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze chromium(2+);bis(heptanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(2+);bis(heptanoate)?
The IUPAC name of chromium(2+);bis(heptanoate) (CID 22759575) is chromium(2+);bis(heptanoate).
What is the SMILES notation for chromium(2+);bis(heptanoate)?
The canonical SMILES for chromium(2+);bis(heptanoate) is CCCCCCC(=O)[O-].CCCCCCC(=O)[O-].[Cr+2].
What is the InChIKey of chromium(2+);bis(heptanoate)?
The InChIKey is CZPDWLPNISOUFN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H14O2.Cr/c2*1-2-3-4-5-6-7(8)9;/h2*2-6H2,1H3,(H,8,9);/q;;+2/p-2.
What are the key properties of chromium(2+);bis(heptanoate)?
chromium(2+);bis(heptanoate) has a molecular weight of 310.35 g/mol, XLogP of 1.41, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(2+);bis(heptanoate) is sourced from PubChem (CID 22759575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).