C15H21NOS — CID 22765035
S-[3-(2-methylpropyl)phenyl] N-cyclobutylcarbamothioate (PubChem CID 22765035) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is S-[3-(2-methylpropyl)phenyl] N-cyclobutylcarbamothioate.
| Compound Name | S-[3-(2-methylpropyl)phenyl] N-cyclobutylcarbamothioate |
|---|---|
| PubChem CID | 22765035 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | S-[3-(2-methylpropyl)phenyl] N-cyclobutylcarbamothioate |
| SMILES | CC(C)Cc1cccc(SC(=O)NC2CCC2)c1 |
| InChI | InChI=1S/C15H21NOS/c1-11(2)9-12-5-3-8-14(10-12)18-15(17)16-13-6-4-7-13/h3,5,8,10-11,13H,4,6-7,9H2,1-2H3,(H,16,17) |
| InChIKey | LFVSFJSPFFTRHG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|