C21H28N2O2 — CID 22767225
[4-(diethylamino)-2,2-diphenylbutyl]carbamic acid (PubChem CID 22767225) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [4-(diethylamino)-2,2-diphenylbutyl]carbamic acid.
| Compound Name | [4-(diethylamino)-2,2-diphenylbutyl]carbamic acid |
|---|---|
| PubChem CID | 22767225 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [4-(diethylamino)-2,2-diphenylbutyl]carbamic acid |
| SMILES | CCN(CC)CCC(CNC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O2/c1-3-23(4-2)16-15-21(17-22-20(24)25,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,22H,3-4,15-17H2,1-2H3,(H,24,25) |
| InChIKey | KQKJIXQFTDVHHW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |