C20H20N7O7S4+ — CID 22767768
7-[[2-[4-(azidomethyl)phenyl]-2-sulfoacetyl]amino]-3-[(2-methyl-1,2,4-thiadiazol-2-ium-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22767768) has the molecular formula C20H20N7O7S4+ and a molecular weight of 598.69 g/mol. Its IUPAC name is 7-[[2-[4-(azidomethyl)phenyl]-2-sulfoacetyl]amino]-3-[(2-methyl-1,2,4-thiadiazol-2-ium-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 7-[[2-[4-(azidomethyl)phenyl]-2-sulfoacetyl]amino]-3-[(2-methyl-1,2,4-thiadiazol-2-ium-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22767768 |
| Molecular Formula | C20H20N7O7S4+ |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.03 |
| IUPAC Name | 7-[[2-[4-(azidomethyl)phenyl]-2-sulfoacetyl]amino]-3-[(2-methyl-1,2,4-thiadiazol-2-ium-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C[n+]1cnc(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)C(c4ccc(CN=[N+]=[N-])cc4)S(=O)(=O)O)C3SC2)s1 |
| InChI | InChI=1S/C20H19N7O7S4/c1-26-9-22-20(37-26)36-8-12-7-35-18-13(17(29)27(18)14(12)19(30)31)24-16(28)15(38(32,33)34)11-4-2-10(3-5-11)6-23-25-21/h2-5,9,13,15,18H,6-8H2,1H3,(H2-,24,28,30,31,32,33,34)/p+1 |
| InChIKey | FKAKHKISRWTFMQ-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 206.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|