C20H20Cl3NO6S — CID 22773076
dipropan-2-yl 5-[(2,4,5-trichlorophenyl)sulfonylamino]benzene-1,3-dicarboxylate (PubChem CID 22773076) has the molecular formula C20H20Cl3NO6S and a molecular weight of 508.81 g/mol. Its IUPAC name is dipropan-2-yl 5-[(2,4,5-trichlorophenyl)sulfonylamino]benzene-1,3-dicarboxylate.
| Compound Name | dipropan-2-yl 5-[(2,4,5-trichlorophenyl)sulfonylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22773076 |
| Molecular Formula | C20H20Cl3NO6S |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | dipropan-2-yl 5-[(2,4,5-trichlorophenyl)sulfonylamino]benzene-1,3-dicarboxylate |
| SMILES | CC(C)OC(=O)c1cc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)cc(C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C20H20Cl3NO6S/c1-10(2)29-19(25)12-5-13(20(26)30-11(3)4)7-14(6-12)24-31(27,28)18-9-16(22)15(21)8-17(18)23/h5-11,24H,1-4H3 |
| InChIKey | RTWDODYGXHIJDZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|