C35H27N3O3S2 — CID 22784251
N-[(Z)-3-[4-(1-carbazol-9-yl-1-oxopropan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22784251) has the molecular formula C35H27N3O3S2 and a molecular weight of 601.75 g/mol. Its IUPAC name is N-[(Z)-3-[4-(1-carbazol-9-yl-1-oxopropan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(1-carbazol-9-yl-1-oxopropan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784251 |
| Molecular Formula | C35H27N3O3S2 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | N-[(Z)-3-[4-(1-carbazol-9-yl-1-oxopropan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)cc1)C(=O)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C35H27N3O3S2/c1-23(35(41)38-31-13-7-5-11-28(31)29-12-6-8-14-32(29)38)43-27-17-15-26(16-18-27)36-34(40)30(21-24-19-20-42-22-24)37-33(39)25-9-3-2-4-10-25/h2-23H,1H3,(H,36,40)(H,37,39)/b30-21- |
| InChIKey | JVZPDSUJZVASHJ-OFWBYEQRSA-N |
| XLogP | 8.09 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|