C9H12O2S2 — CID 22788691
(1S,2R)-2-(1,3-dithiolan-2-yl)cyclopent-3-ene-1-carboxylic acid (PubChem CID 22788691) has the molecular formula C9H12O2S2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (1S,2R)-2-(1,3-dithiolan-2-yl)cyclopent-3-ene-1-carboxylic acid.
| Compound Name | (1S,2R)-2-(1,3-dithiolan-2-yl)cyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22788691 |
| Molecular Formula | C9H12O2S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | (1S,2R)-2-(1,3-dithiolan-2-yl)cyclopent-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=C[C@H]1C1SCCS1 |
| InChI | InChI=1S/C9H12O2S2/c10-8(11)6-2-1-3-7(6)9-12-4-5-13-9/h1,3,6-7,9H,2,4-5H2,(H,10,11)/t6-,7+/m0/s1 |
| InChIKey | DTDROXNEKOXPJD-NKWVEPMBSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|