C10H14O2S2 — CID 22788693
methyl (1S,2R)-2-(1,3-dithiolan-2-yl)cyclopent-3-ene-1-carboxylate (PubChem CID 22788693) has the molecular formula C10H14O2S2 and a molecular weight of 230.35 g/mol. Its IUPAC name is methyl (1S,2R)-2-(1,3-dithiolan-2-yl)cyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1S,2R)-2-(1,3-dithiolan-2-yl)cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 22788693 |
| Molecular Formula | C10H14O2S2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | methyl (1S,2R)-2-(1,3-dithiolan-2-yl)cyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C[C@H]1C1SCCS1 |
| InChI | InChI=1S/C10H14O2S2/c1-12-9(11)7-3-2-4-8(7)10-13-5-6-14-10/h2,4,7-8,10H,3,5-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | ZOHXACCRXSMXNJ-JGVFFNPUSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|