C17H19Cl3N2O6S2 — CID 22792977
4-methylbenzenesulfonic acid;2,2,2-trichloroethyl (6S)-7-amino-4-methyl-8-oxo-5-thia-1-azatricyclo[4.2.0.02,4]octane-2-carboxylate (PubChem CID 22792977) has the molecular formula C17H19Cl3N2O6S2 and a molecular weight of 517.84 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2,2,2-trichloroethyl (6S)-7-amino-4-methyl-8-oxo-5-thia-1-azatricyclo[4.2.0.02,4]octane-2-carboxylate.
| Compound Name | 4-methylbenzenesulfonic acid;2,2,2-trichloroethyl (6S)-7-amino-4-methyl-8-oxo-5-thia-1-azatricyclo[4.2.0.02,4]octane-2-carboxylate |
|---|---|
| PubChem CID | 22792977 |
| Molecular Formula | C17H19Cl3N2O6S2 |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2,2,2-trichloroethyl (6S)-7-amino-4-methyl-8-oxo-5-thia-1-azatricyclo[4.2.0.02,4]octane-2-carboxylate |
| SMILES | CC12CC1(C(=O)OCC(Cl)(Cl)Cl)N1C(=O)C(N)[C@@H]1S2.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H11Cl3N2O3S.C7H8O3S/c1-8-2-9(8,7(17)18-3-10(11,12)13)15-5(16)4(14)6(15)19-8;1-6-2-4-7(5-3-6)11(8,9)10/h4,6H,2-3,14H2,1H3;2-5H,1H3,(H,8,9,10)/t4?,6-,8?,9?;/m0./s1 |
| InChIKey | VOXWHFHFUVGOSI-QZBGMCRVSA-N |
| XLogP | 2.29 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|