C13H20O5 — CID 22797022
2-[(1S,5R)-5-hydroxy-2-(oxan-2-yloxymethyl)cyclopent-2-en-1-yl]acetic acid (PubChem CID 22797022) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[(1S,5R)-5-hydroxy-2-(oxan-2-yloxymethyl)cyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,5R)-5-hydroxy-2-(oxan-2-yloxymethyl)cyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 22797022 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-[(1S,5R)-5-hydroxy-2-(oxan-2-yloxymethyl)cyclopent-2-en-1-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1C(COC2CCCCO2)=CC[C@H]1O |
| InChI | InChI=1S/C13H20O5/c14-11-5-4-9(10(11)7-12(15)16)8-18-13-3-1-2-6-17-13/h4,10-11,13-14H,1-3,5-8H2,(H,15,16)/t10-,11+,13?/m0/s1 |
| InChIKey | ILUXDSICXQQDCR-VUDPYIQVSA-N |
| XLogP | 1.31 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|