C20H27IO6 — CID 21497782
2-[2-hydroxy-3-iodo-4-(oxan-2-yloxy)-5-(phenylmethoxymethyl)cyclopentyl]acetic acid (PubChem CID 21497782) has the molecular formula C20H27IO6 and a molecular weight of 490.33 g/mol. Its IUPAC name is 2-[2-hydroxy-3-iodo-4-(oxan-2-yloxy)-5-(phenylmethoxymethyl)cyclopentyl]acetic acid.
| Compound Name | 2-[2-hydroxy-3-iodo-4-(oxan-2-yloxy)-5-(phenylmethoxymethyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 21497782 |
| Molecular Formula | C20H27IO6 |
| Molecular Weight | 490.33 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2-[2-hydroxy-3-iodo-4-(oxan-2-yloxy)-5-(phenylmethoxymethyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1C(O)C(I)C(OC2CCCCO2)C1COCc1ccccc1 |
| InChI | InChI=1S/C20H27IO6/c21-18-19(24)14(10-16(22)23)15(12-25-11-13-6-2-1-3-7-13)20(18)27-17-8-4-5-9-26-17/h1-3,6-7,14-15,17-20,24H,4-5,8-12H2,(H,22,23) |
| InChIKey | UNLCZNQFWRJXEZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|