C8H12O2 — CID 22797652
cis-(1R,2R)-1,3,3-trimethylcyclopropane-1,2-dicarbaldehyde (PubChem CID 22797652) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is cis-(1R,2R)-1,3,3-trimethylcyclopropane-1,2-dicarbaldehyde.
| Compound Name | cis-(1R,2R)-1,3,3-trimethylcyclopropane-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 22797652 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | cis-(1R,2R)-1,3,3-trimethylcyclopropane-1,2-dicarbaldehyde |
| SMILES | CC1(C)[C@@H](C=O)[C@@]1(C)C=O |
| InChI | InChI=1S/C8H12O2/c1-7(2)6(4-9)8(7,3)5-10/h4-6H,1-3H3/t6-,8-/m1/s1 |
| InChIKey | RAOIZGHPOTYTGJ-HTRCEHHLSA-N |
| XLogP | 1.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|