C9H18NO4PSSi — CID 22798211
(5S)-2-[methoxy(trimethylsilyloxy)phosphoryl]-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 22798211) has the molecular formula C9H18NO4PSSi and a molecular weight of 295.37 g/mol. Its IUPAC name is (5S)-2-[methoxy(trimethylsilyloxy)phosphoryl]-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5S)-2-[methoxy(trimethylsilyloxy)phosphoryl]-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 22798211 |
| Molecular Formula | C9H18NO4PSSi |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (5S)-2-[methoxy(trimethylsilyloxy)phosphoryl]-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | COP(=O)(O[Si](C)(C)C)C1CS[C@H]2CC(=O)N12 |
| InChI | InChI=1S/C9H18NO4PSSi/c1-13-15(12,14-17(2,3)4)8-6-16-9-5-7(11)10(8)9/h8-9H,5-6H2,1-4H3/t8?,9-,15?/m0/s1 |
| InChIKey | VVVOWDKBVQLJGQ-WWNCPBBQSA-N |
| XLogP | 2.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|