C26H25ClN2O3S — CID 22806791
(2S)-2-[[(2S)-2-[[2-(4-chlorophenyl)ethanethioyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 22806791) has the molecular formula C26H25ClN2O3S and a molecular weight of 481.02 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-(4-chlorophenyl)ethanethioyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-(4-chlorophenyl)ethanethioyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22806791 |
| Molecular Formula | C26H25ClN2O3S |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-(4-chlorophenyl)ethanethioyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=S)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25ClN2O3S/c27-21-13-11-20(12-14-21)17-24(33)28-22(15-18-7-3-1-4-8-18)25(30)29-23(26(31)32)16-19-9-5-2-6-10-19/h1-14,22-23H,15-17H2,(H,28,33)(H,29,30)(H,31,32)/t22-,23-/m0/s1 |
| InChIKey | LCFFWGCZUQXZKS-GOTSBHOMSA-N |
| XLogP | 4.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|