C19H28Cl3NO — CID 22813185
(2S,7R,9aR)-2-tert-butyl-7-(2,4-dichlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride (PubChem CID 22813185) has the molecular formula C19H28Cl3NO and a molecular weight of 392.80 g/mol. Its IUPAC name is (2S,7R,9aR)-2-tert-butyl-7-(2,4-dichlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride.
| Compound Name | (2S,7R,9aR)-2-tert-butyl-7-(2,4-dichlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 22813185 |
| Molecular Formula | C19H28Cl3NO |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (2S,7R,9aR)-2-tert-butyl-7-(2,4-dichlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride |
| SMILES | CC(C)(C)[C@]1(O)CCN2C[C@@H](c3ccc(Cl)cc3Cl)CC[C@@H]2C1.Cl |
| InChI | InChI=1S/C19H27Cl2NO.ClH/c1-18(2,3)19(23)8-9-22-12-13(4-6-15(22)11-19)16-7-5-14(20)10-17(16)21;/h5,7,10,13,15,23H,4,6,8-9,11-12H2,1-3H3;1H/t13-,15+,19-;/m0./s1 |
| InChIKey | ILFBXXSEDAUSAR-ICFHWCMISA-N |
| XLogP | 5.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |