C19H29Cl2NO — CID 45260203
(2R,7S,9aR)-2-tert-butyl-7-(2-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride (PubChem CID 45260203) has the molecular formula C19H29Cl2NO and a molecular weight of 358.35 g/mol. Its IUPAC name is (2R,7S,9aR)-2-tert-butyl-7-(2-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride.
| Compound Name | (2R,7S,9aR)-2-tert-butyl-7-(2-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 45260203 |
| Molecular Formula | C19H29Cl2NO |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (2R,7S,9aR)-2-tert-butyl-7-(2-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride |
| SMILES | CC(C)(C)[C@@]1(O)CCN2C[C@H](c3ccccc3Cl)CC[C@@H]2C1.Cl |
| InChI | InChI=1S/C19H28ClNO.ClH/c1-18(2,3)19(22)10-11-21-13-14(8-9-15(21)12-19)16-6-4-5-7-17(16)20;/h4-7,14-15,22H,8-13H2,1-3H3;1H/t14-,15-,19-;/m1./s1 |
| InChIKey | ZZFFDTAKRMLYLN-ATBNALFTSA-N |
| XLogP | 4.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |