C24H36NO7P — CID 22826620
(2S)-1-[2-[(3,3-dimethyl-2-oxobutoxy)-(4-phenylbutyl)phosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 22826620) has the molecular formula C24H36NO7P and a molecular weight of 481.53 g/mol. Its IUPAC name is (2S)-1-[2-[(3,3-dimethyl-2-oxobutoxy)-(4-phenylbutyl)phosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[(3,3-dimethyl-2-oxobutoxy)-(4-phenylbutyl)phosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22826620 |
| Molecular Formula | C24H36NO7P |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (2S)-1-[2-[(3,3-dimethyl-2-oxobutoxy)-(4-phenylbutyl)phosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(OP(=O)(CCCCc1ccccc1)OCC(=O)C(C)(C)C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C24H36NO7P/c1-18(22(27)25-15-10-14-20(25)23(28)29)32-33(30,31-17-21(26)24(2,3)4)16-9-8-13-19-11-6-5-7-12-19/h5-7,11-12,18,20H,8-10,13-17H2,1-4H3,(H,28,29)/t18?,20-,33?/m0/s1 |
| InChIKey | SMOJLRNYURHSHG-PJWFNJFXSA-N |
| XLogP | 4.31 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|