C23H24N4O3S — CID 22829653
butyl 2-[[4-(2,4-dimethylphenyl)-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl]sulfanyl]acetate (PubChem CID 22829653) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is butyl 2-[[4-(2,4-dimethylphenyl)-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl]sulfanyl]acetate.
| Compound Name | butyl 2-[[4-(2,4-dimethylphenyl)-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 22829653 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | butyl 2-[[4-(2,4-dimethylphenyl)-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl]sulfanyl]acetate |
| SMILES | CCCCOC(=O)CSc1nnc2n(-c3ccc(C)cc3C)c(=O)c3ccccc3n12 |
| InChI | InChI=1S/C23H24N4O3S/c1-4-5-12-30-20(28)14-31-23-25-24-22-26(18-11-10-15(2)13-16(18)3)21(29)17-8-6-7-9-19(17)27(22)23/h6-11,13H,4-5,12,14H2,1-3H3 |
| InChIKey | MFKNOKRUKDKKQD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|