C23H21N5O2S — CID 42984519
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-4-(2,4-dimethylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 42984519) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-4-(2,4-dimethylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-4-(2,4-dimethylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 42984519 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-4-(2,4-dimethylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1ccc(-n2c(=O)c3ccccc3n3c(SCc4c(C)noc4C)nnc23)c(C)c1 |
| InChI | InChI=1S/C23H21N5O2S/c1-13-9-10-19(14(2)11-13)27-21(29)17-7-5-6-8-20(17)28-22(27)24-25-23(28)31-12-18-15(3)26-30-16(18)4/h5-11H,12H2,1-4H3 |
| InChIKey | RXUFBVYVUTVYEF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |