C25H19N7O2S — CID 42983251
4-(2,4-dimethylphenyl)-1-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 42983251) has the molecular formula C25H19N7O2S and a molecular weight of 481.54 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-1-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-(2,4-dimethylphenyl)-1-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 42983251 |
| Molecular Formula | C25H19N7O2S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-1-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1ccc(-n2c(=O)c3ccccc3n3c(SCn4nnc5ccccc5c4=O)nnc23)c(C)c1 |
| InChI | InChI=1S/C25H19N7O2S/c1-15-11-12-20(16(2)13-15)31-23(34)18-8-4-6-10-21(18)32-24(31)27-28-25(32)35-14-30-22(33)17-7-3-5-9-19(17)26-29-30/h3-13H,14H2,1-2H3 |
| InChIKey | RWTDMXLEPBWPNX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 99.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |