C24H24N6O2S — CID 55544710
1-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-4-(2,4-dimethylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 55544710) has the molecular formula C24H24N6O2S and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-4-(2,4-dimethylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-4-(2,4-dimethylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 55544710 |
| Molecular Formula | C24H24N6O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 1-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-4-(2,4-dimethylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1ccc(-n2c(=O)c3ccccc3n3c(SCc4nc(C(C)(C)C)no4)nnc23)c(C)c1 |
| InChI | InChI=1S/C24H24N6O2S/c1-14-10-11-17(15(2)12-14)29-20(31)16-8-6-7-9-18(16)30-22(29)26-27-23(30)33-13-19-25-21(28-32-19)24(3,4)5/h6-12H,13H2,1-5H3 |
| InChIKey | UVJGEHSSCPSYRZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |