C26H32O4Ti+2 — CID 22834021
[(2Z,12Z)-3,12-dihydroxy-14-oxoniumylidene-1,14-diphenyltetradeca-2,12-dienylidene]oxidanium;titanium (PubChem CID 22834021) has the molecular formula C26H32O4Ti+2 and a molecular weight of 456.40 g/mol. Its IUPAC name is [(2Z,12Z)-3,12-dihydroxy-14-oxoniumylidene-1,14-diphenyltetradeca-2,12-dienylidene]oxidanium;titanium.
| Compound Name | [(2Z,12Z)-3,12-dihydroxy-14-oxoniumylidene-1,14-diphenyltetradeca-2,12-dienylidene]oxidanium;titanium |
|---|---|
| PubChem CID | 22834021 |
| Molecular Formula | C26H32O4Ti+2 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [(2Z,12Z)-3,12-dihydroxy-14-oxoniumylidene-1,14-diphenyltetradeca-2,12-dienylidene]oxidanium;titanium |
| SMILES | [H]/[O+]=C(/C=C(\O)CCCCCCCC/C(O)=C/C(=[O+]\[H])c1ccccc1)c1ccccc1.[Ti] |
| InChI | InChI=1S/C26H30O4.Ti/c27-23(19-25(29)21-13-7-5-8-14-21)17-11-3-1-2-4-12-18-24(28)20-26(30)22-15-9-6-10-16-22;/h5-10,13-16,19-20,27-28H,1-4,11-12,17-18H2;/p+2/b23-19-,24-20-; |
| InChIKey | RAUSUNYANLQJHZ-MYBUCKEHSA-P |
| XLogP | 6.17 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|