About bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium
bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium (PubChem CID 22834292) has the molecular formula C20H20Br2O4Ti+2
and a molecular weight of 532.05 g/mol. Its IUPAC name is bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium.
Molecular Properties
| Compound Name | bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium |
| PubChem CID | 22834292 |
| Molecular Formula | C20H20Br2O4Ti+2 |
| Molecular Weight | 532.05 g/mol |
| Exact Mass | 529.92 |
| IUPAC Name | bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium |
| SMILES | [H]/[O+]=C(\C=C(\C)O)c1ccc(Br)cc1.[H]/[O+]=C(\C=C(\C)O)c1ccc(Br)cc1.[Ti] |
| InChI | InChI=1S/2C10H9BrO2.Ti/c2*1-7(12)6-10(13)8-2-4-9(11)5-3-8;/h2*2-6,12H,1H3;/p+2/b2*7-6-; |
| InChIKey | QDYXOHKTRMKKRF-SVDRMMRJSA-P |
| XLogP | 5.61 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.05 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium?
The IUPAC name of bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium (CID 22834292) is bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium.
What is the SMILES notation for bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium?
The canonical SMILES for bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium is [H]/[O+]=C(\C=C(\C)O)c1ccc(Br)cc1.[H]/[O+]=C(\C=C(\C)O)c1ccc(Br)cc1.[Ti].
What is the InChIKey of bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium?
The InChIKey is QDYXOHKTRMKKRF-SVDRMMRJSA-P. The full InChI is InChI=1S/2C10H9BrO2.Ti/c2*1-7(12)6-10(13)8-2-4-9(11)5-3-8;/h2*2-6,12H,1H3;/p+2/b2*7-6-;.
What are the key properties of bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium?
bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium has a molecular weight of 532.05 g/mol, XLogP of 5.61, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis([(Z)-1-(4-bromophenyl)-3-hydroxybut-2-enylidene]oxidanium);titanium is sourced from PubChem (CID 22834292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).