C18H15N — CID 22835573
3,3-diphenyl-N-prop-2-ynylprop-2-en-1-imine (PubChem CID 22835573) has the molecular formula C18H15N and a molecular weight of 245.32 g/mol. Its IUPAC name is 3,3-diphenyl-N-prop-2-ynylprop-2-en-1-imine.
| Compound Name | 3,3-diphenyl-N-prop-2-ynylprop-2-en-1-imine |
|---|---|
| PubChem CID | 22835573 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3,3-diphenyl-N-prop-2-ynylprop-2-en-1-imine |
| SMILES | C#CC/N=C/C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15N/c1-2-14-19-15-13-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h1,3-13,15H,14H2/b19-15+ |
| InChIKey | FVAUIDLFQRRJJR-XDJHFCHBSA-N |
| XLogP | 3.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|