About 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone
1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone (PubChem CID 102475202) has the molecular formula C23H19NO
and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone |
| PubChem CID | 102475202 |
| Molecular Formula | C23H19NO |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/N=C/C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO/c1-18(25)19-12-14-22(15-13-19)24-17-16-23(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-17H,1H3/b24-17+ |
| InChIKey | FDXIPGPVKHQUKB-JJIBRWJFSA-N |
| XLogP | 5.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone?
The IUPAC name of 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone (CID 102475202) is 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone.
What is the SMILES notation for 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone?
The canonical SMILES for 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone is CC(=O)c1ccc(/N=C/C=C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone?
The InChIKey is FDXIPGPVKHQUKB-JJIBRWJFSA-N. The full InChI is InChI=1S/C23H19NO/c1-18(25)19-12-14-22(15-13-19)24-17-16-23(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-17H,1H3/b24-17+.
What are the key properties of 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone?
1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone has a molecular weight of 325.41 g/mol, XLogP of 5.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,3-diphenylprop-2-enylideneamino)phenyl]ethanone is sourced from PubChem (CID 102475202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).