C10H14N2O2 — CID 22839052
2-[(3aR,7aS)-2-oxo-3a,4,5,7a-tetrahydro-3H-indol-1-yl]acetamide (PubChem CID 22839052) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-[(3aR,7aS)-2-oxo-3a,4,5,7a-tetrahydro-3H-indol-1-yl]acetamide.
| Compound Name | 2-[(3aR,7aS)-2-oxo-3a,4,5,7a-tetrahydro-3H-indol-1-yl]acetamide |
|---|---|
| PubChem CID | 22839052 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-[(3aR,7aS)-2-oxo-3a,4,5,7a-tetrahydro-3H-indol-1-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)C[C@H]2CCC=C[C@H]21 |
| InChI | InChI=1S/C10H14N2O2/c11-9(13)6-12-8-4-2-1-3-7(8)5-10(12)14/h2,4,7-8H,1,3,5-6H2,(H2,11,13)/t7-,8-/m1/s1 |
| InChIKey | BBHPKODPJDMEBK-HTQZYQBOSA-N |
| XLogP | 0.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|