C5H8N2O2S2 — CID 141266040
2-(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)acetamide (PubChem CID 141266040) has the molecular formula C5H8N2O2S2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | 2-(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 141266040 |
| Molecular Formula | C5H8N2O2S2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | 2-(4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl)acetamide |
| SMILES | NC(=O)CN1C(=O)CSC1S |
| InChI | InChI=1S/C5H8N2O2S2/c6-3(8)1-7-4(9)2-11-5(7)10/h5,10H,1-2H2,(H2,6,8) |
| InChIKey | BOWFDMHDRVXLFW-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|