C19H39N3O2 — CID 22841821
2-(1,1-dideuteriooctylamino)-N-(octylcarbamoyl)acetamide (PubChem CID 22841821) has the molecular formula C19H39N3O2 and a molecular weight of 343.55 g/mol. Its IUPAC name is 2-(1,1-dideuteriooctylamino)-N-(octylcarbamoyl)acetamide.
| Compound Name | 2-(1,1-dideuteriooctylamino)-N-(octylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 22841821 |
| Molecular Formula | C19H39N3O2 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | 2-(1,1-dideuteriooctylamino)-N-(octylcarbamoyl)acetamide |
| SMILES | [2H]C([2H])(CCCCCCC)NCC(=O)NC(=O)NCCCCCCCC |
| InChI | InChI=1S/C19H39N3O2/c1-3-5-7-9-11-13-15-20-17-18(23)22-19(24)21-16-14-12-10-8-6-4-2/h20H,3-17H2,1-2H3,(H2,21,22,23,24)/i15D2 |
| InChIKey | HGESDZUHFKEMJG-DOBBINOXSA-N |
| XLogP | 4.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|