C33H54O — CID 22841920
bis[(1S,2R,5S,7R,8R)-2-ethyl-6,6,8-trimethyl-2-tricyclo[5.3.1.01,5]undecanyl]methanone (PubChem CID 22841920) has the molecular formula C33H54O and a molecular weight of 466.79 g/mol. Its IUPAC name is bis[(1S,2R,5S,7R,8R)-2-ethyl-6,6,8-trimethyl-2-tricyclo[5.3.1.01,5]undecanyl]methanone.
| Compound Name | bis[(1S,2R,5S,7R,8R)-2-ethyl-6,6,8-trimethyl-2-tricyclo[5.3.1.01,5]undecanyl]methanone |
|---|---|
| PubChem CID | 22841920 |
| Molecular Formula | C33H54O |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 466.42 |
| IUPAC Name | bis[(1S,2R,5S,7R,8R)-2-ethyl-6,6,8-trimethyl-2-tricyclo[5.3.1.01,5]undecanyl]methanone |
| SMILES | CC[C@@]1(C(=O)[C@]2(CC)CC[C@H]3C(C)(C)[C@@H]4C[C@@]32CC[C@H]4C)CC[C@H]2C(C)(C)[C@@H]3C[C@@]21CC[C@H]3C |
| InChI | InChI=1S/C33H54O/c1-9-30(17-13-25-28(5,6)23-19-32(25,30)15-11-21(23)3)27(34)31(10-2)18-14-26-29(7,8)24-20-33(26,31)16-12-22(24)4/h21-26H,9-20H2,1-8H3/t21-,22-,23-,24-,25+,26+,30+,31+,32+,33+/m1/s1 |
| InChIKey | NLKKHQXAGUACPM-VBPSSQHUSA-N |
| XLogP | 9.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |