C20H32O5 — CID 22847467
methyl (4E,8E)-2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate (PubChem CID 22847467) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is methyl (4E,8E)-2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate.
| Compound Name | methyl (4E,8E)-2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate |
|---|---|
| PubChem CID | 22847467 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl (4E,8E)-2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate |
| SMILES | COC(=O)C(C/C=C(\C)CC/C=C(\C)COC1CCCCO1)C(C)=O |
| InChI | InChI=1S/C20H32O5/c1-15(11-12-18(17(3)21)20(22)23-4)8-7-9-16(2)14-25-19-10-5-6-13-24-19/h9,11,18-19H,5-8,10,12-14H2,1-4H3/b15-11+,16-9+ |
| InChIKey | NEARTNVEKBLUHG-NRKALEDUSA-N |
| XLogP | 3.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|