C10H18O7S — CID 22850992
2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetic acid (PubChem CID 22850992) has the molecular formula C10H18O7S and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetic acid.
| Compound Name | 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 22850992 |
| Molecular Formula | C10H18O7S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetic acid |
| SMILES | CC1(C)O[C@H](COS(C)(=O)=O)C[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C10H18O7S/c1-10(2)16-7(5-9(11)12)4-8(17-10)6-15-18(3,13)14/h7-8H,4-6H2,1-3H3,(H,11,12)/t7-,8+/m1/s1 |
| InChIKey | UZDBNVGMWJFIJM-SFYZADRCSA-N |
| XLogP | 0.35 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|