C11H24N2O3S — CID 22853555
(2R)-2-amino-3-sulfanylpropanoic acid;N-hexylacetamide (PubChem CID 22853555) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;N-hexylacetamide.
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;N-hexylacetamide |
|---|---|
| PubChem CID | 22853555 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;N-hexylacetamide |
| SMILES | CCCCCCNC(C)=O.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C8H17NO.C3H7NO2S/c1-3-4-5-6-7-9-8(2)10;4-2(1-7)3(5)6/h3-7H2,1-2H3,(H,9,10);2,7H,1,4H2,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | YOOGEKUJLCAUOC-WNQIDUERSA-N |
| XLogP | 1.03 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|