C30H42O4Si — CID 22853983
[(8'R,9'S,10'R,11'S,13'S,14'S)-11'-(4-methoxyphenyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]oxy-trimethylsilane (PubChem CID 22853983) has the molecular formula C30H42O4Si and a molecular weight of 494.75 g/mol. Its IUPAC name is [(8'R,9'S,10'R,11'S,13'S,14'S)-11'-(4-methoxyphenyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]oxy-trimethylsilane.
| Compound Name | [(8'R,9'S,10'R,11'S,13'S,14'S)-11'-(4-methoxyphenyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 22853983 |
| Molecular Formula | C30H42O4Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [(8'R,9'S,10'R,11'S,13'S,14'S)-11'-(4-methoxyphenyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]oxy-trimethylsilane |
| SMILES | COc1ccc([C@H]2C[C@]3(C)C(O[Si](C)(C)C)=CC[C@H]3[C@@H]3CC=C4CC5(CC[C@@H]4[C@H]32)OCCO5)cc1 |
| InChI | InChI=1S/C30H42O4Si/c1-29-19-25(20-6-9-22(31-2)10-7-20)28-23-14-15-30(32-16-17-33-30)18-21(23)8-11-24(28)26(29)12-13-27(29)34-35(3,4)5/h6-10,13,23-26,28H,11-12,14-19H2,1-5H3/t23-,24-,25+,26-,28+,29-/m0/s1 |
| InChIKey | LULUZSFWTJLKCO-XANUOQKZSA-N |
| XLogP | 7.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|