About (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid
(2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid (PubChem CID 22857523) has the molecular formula C10H19N3O4S
and a molecular weight of 277.35 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid |
| PubChem CID | 22857523 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid |
| SMILES | CSCC[C@H](N)C(N)=O.O=C1CCC(C(=O)O)N1 |
| InChI | InChI=1S/C5H12N2OS.C5H7NO3/c1-9-3-2-4(6)5(7)8;7-4-2-1-3(6-4)5(8)9/h4H,2-3,6H2,1H3,(H2,7,8);3H,1-2H2,(H,6,7)(H,8,9)/t4-;/m0./s1 |
| InChIKey | VKWVNJHIPREDGT-WCCKRBBISA-N |
| XLogP | -1.10 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid?
The IUPAC name of (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid (CID 22857523) is (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid is CSCC[C@H](N)C(N)=O.O=C1CCC(C(=O)O)N1.
What is the InChIKey of (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid?
The InChIKey is VKWVNJHIPREDGT-WCCKRBBISA-N. The full InChI is InChI=1S/C5H12N2OS.C5H7NO3/c1-9-3-2-4(6)5(7)8;7-4-2-1-3(6-4)5(8)9/h4H,2-3,6H2,1H3,(H2,7,8);3H,1-2H2,(H,6,7)(H,8,9)/t4-;/m0./s1.
What are the key properties of (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid?
(2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid has a molecular weight of 277.35 g/mol, XLogP of -1.10, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-methylsulfanylbutanamide;5-oxopyrrolidine-2-carboxylic acid is sourced from PubChem (CID 22857523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).