C28H20F2O6-2 — CID 22859313
(4R,5R)-2-[4-[2-[2,3-difluoro-4-(4-propylphenyl)phenyl]ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 22859313) has the molecular formula C28H20F2O6-2 and a molecular weight of 490.46 g/mol. Its IUPAC name is (4R,5R)-2-[4-[2-[2,3-difluoro-4-(4-propylphenyl)phenyl]ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | (4R,5R)-2-[4-[2-[2,3-difluoro-4-(4-propylphenyl)phenyl]ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 22859313 |
| Molecular Formula | C28H20F2O6-2 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (4R,5R)-2-[4-[2-[2,3-difluoro-4-(4-propylphenyl)phenyl]ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCCc1ccc(-c2ccc(C#Cc3ccc(C4O[C@@H](C(=O)[O-])[C@H](C(=O)[O-])O4)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H22F2O6/c1-2-3-16-4-9-18(10-5-16)21-15-14-19(22(29)23(21)30)11-6-17-7-12-20(13-8-17)28-35-24(26(31)32)25(36-28)27(33)34/h4-5,7-10,12-15,24-25,28H,2-3H2,1H3,(H,31,32)(H,33,34)/p-2/t24-,25-/m1/s1 |
| InChIKey | BYHYEJKTHUABKF-JWQCQUIFSA-L |
| XLogP | 2.27 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|