C35H44N2O4 — CID 22863439
tert-butyl N-[4-[4-[[(2S,4R)-1-(2-naphthalen-1-ylethyl)-5-oxo-4-prop-2-enylpyrrolidin-2-yl]methoxy]phenyl]butyl]carbamate (PubChem CID 22863439) has the molecular formula C35H44N2O4 and a molecular weight of 556.75 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[(2S,4R)-1-(2-naphthalen-1-ylethyl)-5-oxo-4-prop-2-enylpyrrolidin-2-yl]methoxy]phenyl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[(2S,4R)-1-(2-naphthalen-1-ylethyl)-5-oxo-4-prop-2-enylpyrrolidin-2-yl]methoxy]phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 22863439 |
| Molecular Formula | C35H44N2O4 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | tert-butyl N-[4-[4-[[(2S,4R)-1-(2-naphthalen-1-ylethyl)-5-oxo-4-prop-2-enylpyrrolidin-2-yl]methoxy]phenyl]butyl]carbamate |
| SMILES | C=CC[C@@H]1C[C@@H](COc2ccc(CCCCNC(=O)OC(C)(C)C)cc2)N(CCc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C35H44N2O4/c1-5-11-29-24-30(37(33(29)38)23-21-28-15-10-14-27-13-6-7-16-32(27)28)25-40-31-19-17-26(18-20-31)12-8-9-22-36-34(39)41-35(2,3)4/h5-7,10,13-20,29-30H,1,8-9,11-12,21-25H2,2-4H3,(H,36,39)/t29-,30+/m1/s1 |
| InChIKey | AQADNRNMPDHBAD-IHLOFXLRSA-N |
| XLogP | 7.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|