C22H33NO6 — CID 22866084
(2R)-2,3-ditert-butyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanedioic acid (PubChem CID 22866084) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is (2R)-2,3-ditert-butyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanedioic acid.
| Compound Name | (2R)-2,3-ditert-butyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 22866084 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (2R)-2,3-ditert-butyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanedioic acid |
| SMILES | CN(C(=O)OCc1ccccc1)[C@](C(=O)O)(C(CC(=O)O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H33NO6/c1-20(2,3)16(13-17(24)25)22(18(26)27,21(4,5)6)23(7)19(28)29-14-15-11-9-8-10-12-15/h8-12,16H,13-14H2,1-7H3,(H,24,25)(H,26,27)/t16?,22-/m0/s1 |
| InChIKey | UBRODBBANCGJPO-XLDIYJRPSA-N |
| XLogP | 4.26 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |