C20H30N4O3 — CID 22866402
(2S)-4-methyl-2-[methyl-[6-(2-methylimidazo[4,5-c]pyridin-1-yl)hexanoyl]amino]pentanoic acid (PubChem CID 22866402) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is (2S)-4-methyl-2-[methyl-[6-(2-methylimidazo[4,5-c]pyridin-1-yl)hexanoyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[methyl-[6-(2-methylimidazo[4,5-c]pyridin-1-yl)hexanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 22866402 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (2S)-4-methyl-2-[methyl-[6-(2-methylimidazo[4,5-c]pyridin-1-yl)hexanoyl]amino]pentanoic acid |
| SMILES | Cc1nc2cnccc2n1CCCCCC(=O)N(C)[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C20H30N4O3/c1-14(2)12-18(20(26)27)23(4)19(25)8-6-5-7-11-24-15(3)22-16-13-21-10-9-17(16)24/h9-10,13-14,18H,5-8,11-12H2,1-4H3,(H,26,27)/t18-/m0/s1 |
| InChIKey | RWXMNXBAEMJTNG-SFHVURJKSA-N |
| XLogP | 3.26 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|