C21H32N4O3 — CID 22866351
ethyl (2S)-4-methyl-2-[methyl-[5-(2-methylimidazo[4,5-c]pyridin-1-yl)pentanoyl]amino]pentanoate (PubChem CID 22866351) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-2-[methyl-[5-(2-methylimidazo[4,5-c]pyridin-1-yl)pentanoyl]amino]pentanoate.
| Compound Name | ethyl (2S)-4-methyl-2-[methyl-[5-(2-methylimidazo[4,5-c]pyridin-1-yl)pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 22866351 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | ethyl (2S)-4-methyl-2-[methyl-[5-(2-methylimidazo[4,5-c]pyridin-1-yl)pentanoyl]amino]pentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)N(C)C(=O)CCCCn1c(C)nc2cnccc21 |
| InChI | InChI=1S/C21H32N4O3/c1-6-28-21(27)19(13-15(2)3)24(5)20(26)9-7-8-12-25-16(4)23-17-14-22-11-10-18(17)25/h10-11,14-15,19H,6-9,12-13H2,1-5H3/t19-/m0/s1 |
| InChIKey | PLXATULOUDNMQT-IBGZPJMESA-N |
| XLogP | 3.35 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|