C23H36N4O3 — CID 57264120
ethyl (2S)-4-methyl-2-[8-(2-methylimidazo[4,5-c]pyridin-3-yl)octanoylamino]pentanoate (PubChem CID 57264120) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-2-[8-(2-methylimidazo[4,5-c]pyridin-3-yl)octanoylamino]pentanoate.
| Compound Name | ethyl (2S)-4-methyl-2-[8-(2-methylimidazo[4,5-c]pyridin-3-yl)octanoylamino]pentanoate |
|---|---|
| PubChem CID | 57264120 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | ethyl (2S)-4-methyl-2-[8-(2-methylimidazo[4,5-c]pyridin-3-yl)octanoylamino]pentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NC(=O)CCCCCCCn1c(C)nc2ccncc21 |
| InChI | InChI=1S/C23H36N4O3/c1-5-30-23(29)20(15-17(2)3)26-22(28)11-9-7-6-8-10-14-27-18(4)25-19-12-13-24-16-21(19)27/h12-13,16-17,20H,5-11,14-15H2,1-4H3,(H,26,28)/t20-/m0/s1 |
| InChIKey | OTEBRHOUIMBHGZ-FQEVSTJZSA-N |
| XLogP | 4.17 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|