C25H38N6O2 — CID 57204058
N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)-3-methylpentyl]-8-(2-methylimidazo[4,5-c]pyridin-1-yl)octanamide (PubChem CID 57204058) has the molecular formula C25H38N6O2 and a molecular weight of 454.62 g/mol. Its IUPAC name is N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)-3-methylpentyl]-8-(2-methylimidazo[4,5-c]pyridin-1-yl)octanamide.
| Compound Name | N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)-3-methylpentyl]-8-(2-methylimidazo[4,5-c]pyridin-1-yl)octanamide |
|---|---|
| PubChem CID | 57204058 |
| Molecular Formula | C25H38N6O2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)-3-methylpentyl]-8-(2-methylimidazo[4,5-c]pyridin-1-yl)octanamide |
| SMILES | CCc1noc(C(CC(C)CC)NC(=O)CCCCCCCn2c(C)nc3cnccc32)n1 |
| InChI | InChI=1S/C25H38N6O2/c1-5-18(3)16-20(25-29-23(6-2)30-33-25)28-24(32)12-10-8-7-9-11-15-31-19(4)27-21-17-26-14-13-22(21)31/h13-14,17-18,20H,5-12,15-16H2,1-4H3,(H,28,32) |
| InChIKey | NAKUSPFICLAUJG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|