C22H34N4O3 — CID 22866327
ethyl (2S)-4-methyl-2-[7-(2-methylimidazo[4,5-c]pyridin-1-yl)heptanoylamino]pentanoate (PubChem CID 22866327) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-2-[7-(2-methylimidazo[4,5-c]pyridin-1-yl)heptanoylamino]pentanoate.
| Compound Name | ethyl (2S)-4-methyl-2-[7-(2-methylimidazo[4,5-c]pyridin-1-yl)heptanoylamino]pentanoate |
|---|---|
| PubChem CID | 22866327 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | ethyl (2S)-4-methyl-2-[7-(2-methylimidazo[4,5-c]pyridin-1-yl)heptanoylamino]pentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NC(=O)CCCCCCn1c(C)nc2cnccc21 |
| InChI | InChI=1S/C22H34N4O3/c1-5-29-22(28)18(14-16(2)3)25-21(27)10-8-6-7-9-13-26-17(4)24-19-15-23-12-11-20(19)26/h11-12,15-16,18H,5-10,13-14H2,1-4H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | YWXCCYZYIZLLBI-SFHVURJKSA-N |
| XLogP | 3.78 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|