C22H32N4O5 — CID 57116228
(2S)-2-[ethoxycarbonyl-[6-(2-methylimidazo[4,5-c]pyridin-1-yl)hexanoyl]amino]-4-methylpentanoic acid (PubChem CID 57116228) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (2S)-2-[ethoxycarbonyl-[6-(2-methylimidazo[4,5-c]pyridin-1-yl)hexanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[ethoxycarbonyl-[6-(2-methylimidazo[4,5-c]pyridin-1-yl)hexanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 57116228 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (2S)-2-[ethoxycarbonyl-[6-(2-methylimidazo[4,5-c]pyridin-1-yl)hexanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCOC(=O)N(C(=O)CCCCCn1c(C)nc2cnccc21)[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C22H32N4O5/c1-5-31-22(30)26(19(21(28)29)13-15(2)3)20(27)9-7-6-8-12-25-16(4)24-17-14-23-11-10-18(17)25/h10-11,14-15,19H,5-9,12-13H2,1-4H3,(H,28,29)/t19-/m0/s1 |
| InChIKey | WKAFSJHYDMXYHO-IBGZPJMESA-N |
| XLogP | 3.78 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|