C14H19NO4S — CID 22868727
(2S)-2-[[3-(4-hydroxyphenyl)-2-(sulfanylmethyl)butanoyl]amino]propanoic acid (PubChem CID 22868727) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (2S)-2-[[3-(4-hydroxyphenyl)-2-(sulfanylmethyl)butanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[3-(4-hydroxyphenyl)-2-(sulfanylmethyl)butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22868727 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2S)-2-[[3-(4-hydroxyphenyl)-2-(sulfanylmethyl)butanoyl]amino]propanoic acid |
| SMILES | CC(c1ccc(O)cc1)C(CS)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H19NO4S/c1-8(10-3-5-11(16)6-4-10)12(7-20)13(17)15-9(2)14(18)19/h3-6,8-9,12,16,20H,7H2,1-2H3,(H,15,17)(H,18,19)/t8?,9-,12?/m0/s1 |
| InChIKey | KPZPUOSDRSOFQN-XEVUQIKYSA-N |
| XLogP | 1.63 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|