C23H27NO5S — CID 54412918
benzyl (2S)-2-[[2-(acetylsulfanylmethyl)-3-(4-hydroxyphenyl)butanoyl]amino]propanoate (PubChem CID 54412918) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-(acetylsulfanylmethyl)-3-(4-hydroxyphenyl)butanoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[2-(acetylsulfanylmethyl)-3-(4-hydroxyphenyl)butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 54412918 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | benzyl (2S)-2-[[2-(acetylsulfanylmethyl)-3-(4-hydroxyphenyl)butanoyl]amino]propanoate |
| SMILES | CC(=O)SCC(C(=O)N[C@@H](C)C(=O)OCc1ccccc1)C(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H27NO5S/c1-15(19-9-11-20(26)12-10-19)21(14-30-17(3)25)22(27)24-16(2)23(28)29-13-18-7-5-4-6-8-18/h4-12,15-16,21,26H,13-14H2,1-3H3,(H,24,27)/t15?,16-,21?/m0/s1 |
| InChIKey | VVJYFFMRSOSHLL-TZQQIIETSA-N |
| XLogP | 3.64 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|