C23H25F2NO4S — CID 18980816
benzyl 2-[[2-(acetylsulfanylmethyl)-3-(3,4-difluorophenyl)butanoyl]amino]propanoate (PubChem CID 18980816) has the molecular formula C23H25F2NO4S and a molecular weight of 449.52 g/mol. Its IUPAC name is benzyl 2-[[2-(acetylsulfanylmethyl)-3-(3,4-difluorophenyl)butanoyl]amino]propanoate.
| Compound Name | benzyl 2-[[2-(acetylsulfanylmethyl)-3-(3,4-difluorophenyl)butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 18980816 |
| Molecular Formula | C23H25F2NO4S |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | benzyl 2-[[2-(acetylsulfanylmethyl)-3-(3,4-difluorophenyl)butanoyl]amino]propanoate |
| SMILES | CC(=O)SCC(C(=O)NC(C)C(=O)OCc1ccccc1)C(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H25F2NO4S/c1-14(18-9-10-20(24)21(25)11-18)19(13-31-16(3)27)22(28)26-15(2)23(29)30-12-17-7-5-4-6-8-17/h4-11,14-15,19H,12-13H2,1-3H3,(H,26,28) |
| InChIKey | IROUSIVZCFBXKC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|