C22H25NO8S — CID 22872513
(2R)-2-[2-(4-methylphenyl)sulfonylethyl]-2-(phenylmethoxycarbonylamino)pentanedioic acid (PubChem CID 22872513) has the molecular formula C22H25NO8S and a molecular weight of 463.51 g/mol. Its IUPAC name is (2R)-2-[2-(4-methylphenyl)sulfonylethyl]-2-(phenylmethoxycarbonylamino)pentanedioic acid.
| Compound Name | (2R)-2-[2-(4-methylphenyl)sulfonylethyl]-2-(phenylmethoxycarbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 22872513 |
| Molecular Formula | C22H25NO8S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (2R)-2-[2-(4-methylphenyl)sulfonylethyl]-2-(phenylmethoxycarbonylamino)pentanedioic acid |
| SMILES | Cc1ccc(S(=O)(=O)CC[C@@](CCC(=O)O)(NC(=O)OCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H25NO8S/c1-16-7-9-18(10-8-16)32(29,30)14-13-22(20(26)27,12-11-19(24)25)23-21(28)31-15-17-5-3-2-4-6-17/h2-10H,11-15H2,1H3,(H,23,28)(H,24,25)(H,26,27)/t22-/m1/s1 |
| InChIKey | SMRNPYFXXOFUOR-JOCHJYFZSA-N |
| XLogP | 2.77 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |