C30H30N2O9 — CID 22874482
[(2-methylpropan-2-yl)oxycarbonylamino] (2S)-8-(4-nitro-2-phenylmethoxycarbonylphenoxy)-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 22874482) has the molecular formula C30H30N2O9 and a molecular weight of 562.58 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonylamino] (2S)-8-(4-nitro-2-phenylmethoxycarbonylphenoxy)-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonylamino] (2S)-8-(4-nitro-2-phenylmethoxycarbonylphenoxy)-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 22874482 |
| Molecular Formula | C30H30N2O9 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonylamino] (2S)-8-(4-nitro-2-phenylmethoxycarbonylphenoxy)-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)NOC(=O)[C@H]1CCc2cccc(Oc3ccc([N+](=O)[O-])cc3C(=O)OCc3ccccc3)c2C1 |
| InChI | InChI=1S/C30H30N2O9/c1-30(2,3)40-29(35)31-41-27(33)21-13-12-20-10-7-11-25(23(20)16-21)39-26-15-14-22(32(36)37)17-24(26)28(34)38-18-19-8-5-4-6-9-19/h4-11,14-15,17,21H,12-13,16,18H2,1-3H3,(H,31,35)/t21-/m0/s1 |
| InChIKey | DXHKPOHTVKATJI-NRFANRHFSA-N |
| XLogP | 5.83 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|