C3H10N4O2S2 — CID 22878501
(1R)-1-[2-(diaminomethylidene)hydrazinyl]-2-sulfanylethanesulfinic acid (PubChem CID 22878501) has the molecular formula C3H10N4O2S2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (1R)-1-[2-(diaminomethylidene)hydrazinyl]-2-sulfanylethanesulfinic acid.
| Compound Name | (1R)-1-[2-(diaminomethylidene)hydrazinyl]-2-sulfanylethanesulfinic acid |
|---|---|
| PubChem CID | 22878501 |
| Molecular Formula | C3H10N4O2S2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | (1R)-1-[2-(diaminomethylidene)hydrazinyl]-2-sulfanylethanesulfinic acid |
| SMILES | NC(N)=NN[C@@H](CS)S(=O)O |
| InChI | InChI=1S/C3H10N4O2S2/c4-3(5)7-6-2(1-10)11(8)9/h2,6,10H,1H2,(H,8,9)(H4,4,5,7)/t2-/m1/s1 |
| InChIKey | GFPBGJUXLXBNNF-UWTATZPHSA-N |
| XLogP | -1.76 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|